Determine the necessary mass, volume, or concentration for preparing a solution.
≥95%(GC) for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | C[Si](C)(C)CSC[Si](C)(C)C |
|---|---|
| IUPAC Name | trimethyl(trimethylsilylmethylsulfanylmethyl)silane |
| InChIKey | GISUCMFTNKRCPF-UHFFFAOYSA-N |
| INCHI | 1S/C8H22SSi2/c1-10(2,3)7-9-8-11(4,5)6/h7-8H2,1-6H3 |
| Isomeric SMILES | C[Si](C)(C)CSC[Si](C)(C)C |
| WGK Germany | 3 |
| Molecular Weight | 206.49 |
| Beilstein | 1740050 |
| Reaxy-Rn | 1740046 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1740046&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic salts |
| Class | Organic metal salts |
| Subclass | Organic metalloid salts |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Organic metalloid salts |
| Alternative Parents | Sulfenyl compounds Dialkylthioethers Hydrocarbon derivatives Alkylsilanes |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Organic metalloid salt - Dialkylthioether - Sulfenyl compound - Thioether - Hydrocarbon derivative - Organosilicon compound - Alkylsilane - Organosulfur compound - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as organic metalloid salts. These are organic salt compounds containing a metalloid atom in its ionic form. |
| External Descriptors | Not available |
| Sensitivity | Air Sensitive |
|---|---|
| Refractive Index | 1.46 |
| Flash Point(°F) | 149 °F |
| Flash Point(°C) | 65°C(lit.) |
| Boil Point(°C) | 85°C/12mmHg(lit.) |
| Molecular Weight | 206.500 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 4 |
| Exact Mass | 206.098 Da |
| Monoisotopic Mass | 206.098 Da |
| Topological Polar Surface Area | 25.300 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 96.200 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |