Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | CCOC(=O)CC1(COC1)N.CCOC(=O)CC1(COC1)N.C(=O)(C(=O)O)O |
|---|---|
| IUPAC Name | ethyl 2-(3-aminooxetan-3-yl)acetate;oxalic acid |
| InChIKey | QJUWQJRTMRXSBQ-UHFFFAOYSA-N |
| INCHI | 1S/2C7H13NO3.C2H2O4/c2*1-2-11-6(9)3-7(8)4-10-5-7;3-1(4)2(5)6/h2*2-5,8H2,1H3;(H,3,4)(H,5,6) |
| Isomeric SMILES | CCOC(=O)CC1(COC1)N.CCOC(=O)CC1(COC1)N.C(=O)(C(=O)O)O |
| PubChem CID | 91663844 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives |
| Direct Parent | Beta amino acids and derivatives |
| Alternative Parents | Dicarboxylic acids and derivatives Oxetanes Carboxylic acid esters Oxacyclic compounds Dialkyl ethers Carboxylic acids Organic oxides Monoalkylamines Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Not available |
| Substituents | Beta amino acid or derivatives - Dicarboxylic acid or derivatives - Carboxylic acid ester - Oxetane - Carboxylic acid - Dialkyl ether - Ether - Organoheterocyclic compound - Oxacycle - Organonitrogen compound - Primary aliphatic amine - Organic nitrogen compound - Organic oxide - Amine - Organooxygen compound - Hydrocarbon derivative - Primary amine - Carbonyl group - Organic oxygen compound - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as beta amino acids and derivatives. These are amino acids having a (-NH2) group attached to the beta carbon atom. |
| External Descriptors | Not available |
| Molecular Weight | 408.400 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 12 |
| Rotatable Bond Count | 9 |
| Exact Mass | 408.174 Da |
| Monoisotopic Mass | 408.174 Da |
| Topological Polar Surface Area | 198.000 Ų |
| Heavy Atom Count | 28 |
| Formal Charge | 0 |
| Complexity | 225.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 3 |