Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Information
G6PDi-1 G6PDi-1 is an effective inhibitor of glucose-6-phosphate dehydrogenase (G6PD) . G6PDi-1 depletes NADPH and decreases inflammatory cytokine production.
Targets
G6PD ; NADPH
In vitro
G6PDi-1 effectively inhibits G6PD. Across a range of cultured cells, G6PDi-1 depletes NADPH most strongly in lymphocytes. In T cells but not macrophages, G6PDi-1 markedly decreases inflammatory cytokine production. In neutrophils, it suppresses respiratory burst.
Cell Research(from reference)
Cell lines:HepG2 cells, HCT116 cells, T cells
Concentrations:25 μM, 50 μM, 75 μM, 100 μM
Incubation Time:2 h, 4 h, 6 h
| Pubchem Sid | 504773603 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504773603 |
| Canonical Smiles | C1CCC(=O)C2=CN=C(N=C2C1)NC3=CSC(=C3)C#N |
| IUPAC Name | 4-[(5-oxo-6,7,8,9-tetrahydrocyclohepta[d]pyrimidin-2-yl)amino]thiophene-2-carbonitrile |
| InChIKey | USWCHVCZOGGQQA-UHFFFAOYSA-N |
| INCHI | 1S/C14H12N4OS/c15-6-10-5-9(8-20-10)17-14-16-7-11-12(18-14)3-1-2-4-13(11)19/h5,7-8H,1-4H2,(H,16,17,18) |
| Isomeric SMILES | C1CCC(=O)C2=CN=C(N=C2C1)NC3=CSC(=C3)C#N |
| Molecular Weight | 284.34 |
| Reaxy-Rn | 36021336 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=36021336&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Carbonyl compounds |
| Intermediate Tree Nodes | Ketones - Aryl ketones |
| Direct Parent | Aryl alkyl ketones |
| Alternative Parents | Pyrimidines and pyrimidine derivatives Thiophenes Heteroaromatic compounds Secondary amines Nitriles Azacyclic compounds Organosulfur compounds Organopnictogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Aryl alkyl ketone - Pyrimidine - Heteroaromatic compound - Thiophene - Azacycle - Organoheterocyclic compound - Secondary amine - Nitrile - Organic nitrogen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organosulfur compound - Organonitrogen compound - Amine - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as aryl alkyl ketones. These are ketones have the generic structure RC(=O)R', where R = aryl group and R'=alkyl group. |
| External Descriptors | Not available |
| Solubility | Solubility (25°C) In vitro DMSO: 57 mg/mL (200.46 mM); Water: Insoluble; Ethanol: Insoluble; |
|---|---|
| Molecular Weight | 284.340 g/mol |
| XLogP3 | 2.300 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 2 |
| Exact Mass | 284.073 Da |
| Monoisotopic Mass | 284.073 Da |
| Topological Polar Surface Area | 107.000 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 421.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |