Determine the necessary mass, volume, or concentration for preparing a solution.
AVAILABLE TO ORDER
GRADE & PURITY 10mM in DMSO
Synonyms
11H-Indeno[1,2-b]quinoxalin-11-oneoxime
Storage
Store at -80°C
Shipped In
Dry ice packs + Cold packs
Store at Room Temperature. The product can be stored for up to 12 months.
| Canonical Smiles | C1=CC=C2C(=C1)C(=C3C2=NC4=CC=CC=C4N3)N=O |
|---|---|
| IUPAC Name | 11-nitroso-10H-indeno[1,2-b]quinoxaline |
| InChIKey | YSYIWCNPSZNNKW-UHFFFAOYSA-N |
| INCHI | 1S/C15H9N3O/c19-18-14-10-6-2-1-5-9(10)13-15(14)17-12-8-4-3-7-11(12)16-13/h1-8,17H |
| Isomeric SMILES | C1=CC=C2C(=C1)C(=C3C2=NC4=CC=CC=C4N3)N=O |
| PubChem CID | 619002 |
| Molecular Weight | 247.25 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Diazanaphthalenes |
| Subclass | Benzodiazines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Quinoxalines |
| Alternative Parents | Pyrazines Benzenoids Heteroaromatic compounds Propargyl-type 1,3-dipolar organic compounds C-nitroso compounds Azacyclic compounds Organopnictogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Quinoxaline - Pyrazine - Benzenoid - Heteroaromatic compound - C-nitroso compound - Organic nitroso compound - Propargyl-type 1,3-dipolar organic compound - Organic 1,3-dipolar compound - Azacycle - Organonitrogen compound - Organic oxygen compound - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organic oxide - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as quinoxalines. These are compounds containing a quinoxaline moiety, a bicyclic heterocycle made up of a benzene ring fused to a pyrazine ring. |
| External Descriptors | Not available |
| Sensitivity | Moisture Sensitive |
|---|---|
| Melt Point(°C) | 262 °C |
| Molecular Weight | 247.250 g/mol |
| XLogP3 | 2.700 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 247.075 Da |
| Monoisotopic Mass | 247.075 Da |
| Topological Polar Surface Area | 58.100 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 361.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |