Determine the necessary mass, volume, or concentration for preparing a solution.
≥90% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | C1=CC(=CC=C1NS(=O)(=O)C2=C(C=C(C(=C2)C(=O)O)Cl)Cl)F |
|---|---|
| IUPAC Name | 2,4-dichloro-5-[(4-fluorophenyl)sulfamoyl]benzoic acid |
| InChIKey | DLTMPHWJUYBJGY-UHFFFAOYSA-N |
| INCHI | 1S/C13H8Cl2FNO4S/c14-10-6-11(15)12(5-9(10)13(18)19)22(20,21)17-8-3-1-7(16)2-4-8/h1-6,17H,(H,18,19) |
| Isomeric SMILES | C1=CC(=CC=C1NS(=O)(=O)C2=C(C=C(C(=C2)C(=O)O)Cl)Cl)F |
| PubChem CID | 2325693 |
| Molecular Weight | 364.18 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Benzoic acids and derivatives |
| Intermediate Tree Nodes | Benzoic acids |
| Direct Parent | Dichlorobenzoic acids |
| Alternative Parents | Sulfanilides 2-halobenzoic acids 4-halobenzoic acids Benzenesulfonamides Halobenzoic acids Benzenesulfonyl compounds 1-carboxy-2-haloaromatic compounds Benzoyl derivatives Dichlorobenzenes Fluorobenzenes Organosulfonamides Aryl chlorides Aryl fluorides Vinylogous halides Aminosulfonyl compounds Monocarboxylic acids and derivatives Organochlorides Organofluorides Organonitrogen compounds Organooxygen compounds Organopnictogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | 2,4-dichlorobenzoic acid - Benzenesulfonamide - Sulfanilide - 2-halobenzoic acid or derivatives - 4-halobenzoic acid or derivatives - Halobenzoic acid or derivatives - 2-halobenzoic acid - 4-halobenzoic acid - Halobenzoic acid - Benzenesulfonyl group - Benzoyl - 1-carboxy-2-haloaromatic compound - 1,3-dichlorobenzene - Chlorobenzene - Fluorobenzene - Halobenzene - Aryl halide - Aryl fluoride - Organosulfonic acid amide - Aryl chloride - Vinylogous halide - Sulfonyl - Organosulfonic acid or derivatives - Organic sulfonic acid or derivatives - Aminosulfonyl compound - Carboxylic acid derivative - Carboxylic acid - Monocarboxylic acid or derivatives - Organofluoride - Organic nitrogen compound - Organonitrogen compound - Organooxygen compound - Organopnictogen compound - Organosulfur compound - Hydrocarbon derivative - Organic oxygen compound - Organochloride - Organic oxide - Organohalogen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as dichlorobenzoic acids. These are benzoic acids having two chlorine atoms attached to the carboxylated benzene ring. |
| External Descriptors | Not available |
| Molecular Weight | 364.200 g/mol |
|---|---|
| XLogP3 | 3.300 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 4 |
| Exact Mass | 362.954 Da |
| Monoisotopic Mass | 362.954 Da |
| Topological Polar Surface Area | 91.900 Ų |
| Heavy Atom Count | 22 |
| Formal Charge | 0 |
| Complexity | 505.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |