Determine the necessary mass, volume, or concentration for preparing a solution.
≥95%, with stabilizer BHT for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | CC(=C)C(=O)OCCC[Si](C)(C)Cl |
|---|---|
| IUPAC Name | 3-[chloro(dimethyl)silyl]propyl 2-methylprop-2-enoate |
| InChIKey | OKQXCDUCLYWRHA-UHFFFAOYSA-N |
| INCHI | 1S/C9H17ClO2Si/c1-8(2)9(11)12-6-5-7-13(3,4)10/h1,5-7H2,2-4H3 |
| Isomeric SMILES | CC(=C)C(=O)OCCC[Si](C)(C)Cl |
| WGK Germany | 3 |
| Molecular Weight | 220.77 |
| Beilstein | 2244690 |
| Reaxy-Rn | 2244691 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2244691&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organometallic compounds |
| Class | Organometalloid compounds |
| Subclass | Organosilicon compounds |
| Intermediate Tree Nodes | Organoheterosilanes - Trialkylheterosilanes |
| Direct Parent | Trialkylchlorosilanes |
| Alternative Parents | Silyl monohalides Enoate esters Organochlorosilanes Organic metalloid salts Monocarboxylic acids and derivatives Alkylhalosilanes Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Trialkylchlorosilane - Enoate ester - Alpha,beta-unsaturated carboxylic ester - Silyl monohalide - Carboxylic acid ester - Carboxylic acid derivative - Monocarboxylic acid or derivatives - Alkylhalosilane - Organochlorosilane - Organic metalloid salt - Organooxygen compound - Organic oxygen compound - Organic oxide - Organic salt - Hydrocarbon derivative - Carbonyl group - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as trialkylchlorosilanes. These are organoheterosilanes, bearing a silicon atom linked to three alkyl groups and one chlorine atom. |
| External Descriptors | Not available |
| Sensitivity | Moisture Sensitive,Heat Sensitive |
|---|---|
| Refractive Index | 1.45 |
| Flash Point(°F) | 185 °F |
| Flash Point(°C) | 85 °C |
| Boil Point(°C) | 82 °C/2 mmHg |
| Molecular Weight | 220.770 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 6 |
| Exact Mass | 220.069 Da |
| Monoisotopic Mass | 220.069 Da |
| Topological Polar Surface Area | 26.300 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 202.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |