≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Protected from light,Argon charged Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | C1CCC(CC1)S(=O)[O-].[Na+] |
|---|---|
| IUPAC Name | sodium;cyclohexanesulfinate |
| InChIKey | VKOSCBDFLPBMCB-UHFFFAOYSA-M |
| INCHI | 1S/C6H12O2S.Na/c7-9(8)6-4-2-1-3-5-6;/h6H,1-5H2,(H,7,8);/q;+1/p-1 |
| Isomeric SMILES | C1CCC(CC1)S(=O)[O-].[Na+] |
| Molecular Weight | 170.2 |
| Reaxy-Rn | 4033228 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=4033228&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Sulfinic acids and derivatives |
| Subclass | Alkanesulfinic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Alkanesulfinic acids |
| Alternative Parents | Organosulfur compounds Organic sodium salts Organic oxides Hydrocarbon derivatives Organic cations |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Alkanesulfinic acid - Organic alkali metal salt - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organic sodium salt - Organic salt - Organosulfur compound - Organic cation - Aliphatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as alkanesulfinic acids. These are organosulfur compounds containing an aliphatic group attached to a sulfinic acid group (or a derivative thereof), with the general formula RSO2R' (R= alkyl, R'=H). |
| External Descriptors | Not available |
| Melt Point(°C) | ＞350°C |
|---|---|
| Molecular Weight | 170.210 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 170.038 Da |
| Monoisotopic Mass | 170.038 Da |
| Topological Polar Surface Area | 59.300 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 112.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |
