Determine the necessary mass, volume, or concentration for preparing a solution.
≥90% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Precursor involved in the synthesis of pharmacologically active molecules including:
Selective orally active S1P1 agonists
Water-soluble prodrugs of triazole CS-758 with antifungal activity
Fostriecin analogs as antitumor agents
Reactant involved in:
Phosphitylation of alcohols
Deallylation for the synthesis of nucleoside phosphoramidite
Posphitylation and stereoselective Pudovik rearrangement
Diallyl N,N-diisopropylphosphoramidite may be employed as phophorylating reagent in the following studies:
Preparation of peptide substrates.
Preparation of rhodamine dyes with phosphorylated CH2OH sites.
Synthesis of 3-[4-(bis-allyloxy-phosphoryloxy)-2(R)-hydroxy-3,3-dimethyl-butyrylamino]-thiopropionic acid-S-propylester.
| Pubchem Sid | 504763106 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504763106 |
| Canonical Smiles | CC(C)N(C(C)C)P(OCC=C)OCC=C |
| IUPAC Name | N-bis(prop-2-enoxy)phosphanyl-N-propan-2-ylpropan-2-amine |
| InChIKey | QBLCHHSGJTUNSJ-UHFFFAOYSA-N |
| INCHI | 1S/C12H24NO2P/c1-7-9-14-16(15-10-8-2)13(11(3)4)12(5)6/h7-8,11-12H,1-2,9-10H2,3-6H3 |
| Isomeric SMILES | CC(C)N(C(C)C)P(OCC=C)OCC=C |
| WGK Germany | 3 |
| UN Number | 1993 |
| Packing Group | III |
| Molecular Weight | 245.3 |
| Beilstein | 4383514 |
| Reaxy-Rn | 4383514 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=4383514&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Organooxygen compounds |
| Alternative Parents | Organonitrogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Organic nitrogen compound - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as organooxygen compounds. These are organic compounds containing a bond between a carbon atom and an oxygen atom. |
| External Descriptors | Not available |
| Refractive Index | n20D1.46 (lit.) |
|---|---|
| Flash Point(°F) | 89.6 °F |
| Flash Point(°C) | 32 °C |
| Boil Point(°C) | 130° C (lit.) |
| Melt Point(°C) | 25.69° C (Predicted) |
| Molecular Weight | 245.300 g/mol |
| XLogP3 | 3.100 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 9 |
| Exact Mass | 245.154 Da |
| Monoisotopic Mass | 245.154 Da |
| Topological Polar Surface Area | 21.700 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 187.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |