≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Tetraheptylammonium chloride is an ionic compound used in specialty chemical synthesis
| Pubchem Sid | 488186103 |
|---|---|
| Canonical Smiles | CCCCCCC[N+](CCCCCCC)(CCCCCCC)CCCCCCC.[Cl-] |
| IUPAC Name | tetraheptylazanium;chloride |
| InChIKey | VMJQVRWCDVLJSI-UHFFFAOYSA-M |
| INCHI | 1S/C28H60N.ClH/c1-5-9-13-17-21-25-29(26-22-18-14-10-6-2,27-23-19-15-11-7-3)28-24-20-16-12-8-4;/h5-28H2,1-4H3;1H/q+1;/p-1 |
| Isomeric SMILES | CCCCCCC[N+](CCCCCCC)(CCCCCCC)CCCCCCC.[Cl-] |
| PubChem CID | 82489 |
| Molecular Weight | 446.24 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Class | Organonitrogen compounds |
| Subclass | Quaternary ammonium salts |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Tetraalkylammonium salts |
| Alternative Parents | Organopnictogen compounds Organic chloride salts Hydrocarbon derivatives Amines |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Tetraalkylammonium salt - Organopnictogen compound - Hydrocarbon derivative - Organic chloride salt - Organic salt - Amine - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as tetraalkylammonium salts. These are organonitrogen compounds containing a quaternary ammonium substituted with four alkyl chains. |
| External Descriptors | Not available |
| Boil Point(°C) | 175° C (lit.) |
|---|---|
| Melt Point(°C) | 38-40° C (lit.) |
| Molecular Weight | 446.200 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 24 |
| Exact Mass | 445.441 Da |
| Monoisotopic Mass | 445.441 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 30 |
| Formal Charge | 0 |
| Complexity | 237.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |
B2311040