Determine the necessary mass, volume, or concentration for preparing a solution.
≥96% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Application:
Reactant for synthesis of:
Cyclic guanidines
Five membered heterometallacycloallenes
Benzimidazoles or quinazolines via nucleophilic addition and intramolecular C-C bond formation
Benzoxazole and benzimidazole derivatives via cross-coupling reactions
Gem-difluorodihydrouracil derivatives via addition reactions
Reactant for ketene cycloadditions
| Canonical Smiles | CC1=CC=C(C=C1)N=C=NC2=CC=C(C=C2)C |
|---|---|
| InChIKey | BOSWPVRACYJBSJ-UHFFFAOYSA-N |
| INCHI | 1S/C15H14N2/c1-12-3-7-14(8-4-12)16-11-17-15-9-5-13(2)6-10-15/h3-10H,1-2H3 |
| Isomeric SMILES | CC1=CC=C(C=C1)N=C=NC2=CC=C(C=C2)C |
| WGK Germany | 3 |
| Molecular Weight | 222.29 |
| Reaxy-Rn | 1965360 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1965360&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Toluenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Toluenes |
| Alternative Parents | Propargyl-type 1,3-dipolar organic compounds Carbodiimides Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Toluene - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Carbodiimide - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organonitrogen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as toluenes. These are compounds containing a benzene ring which bears a methane group. |
| External Descriptors | carbodiimide |
| Sensitivity | Moisture sensitive |
|---|---|
| Boil Point(°C) | 221-223° C (lit.) at 20 mmHg |
| Melt Point(°C) | 56-58° C (lit.) |
| Molecular Weight | 222.280 g/mol |
| XLogP3 | 5.300 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 2 |
| Exact Mass | 222.116 Da |
| Monoisotopic Mass | 222.116 Da |
| Topological Polar Surface Area | 24.700 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 244.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |