Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 504766426 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504766426 |
| Canonical Smiles | C(CNCCNCCC(=O)O)C(=O)O.Cl.Cl |
| IUPAC Name | 3-[2-(2-carboxyethylamino)ethylamino]propanoic acid;dihydrochloride |
| InChIKey | GSRDLTQJRCGIQI-UHFFFAOYSA-N |
| INCHI | 1S/C8H16N2O4.2ClH/c11-7(12)1-3-9-5-6-10-4-2-8(13)14;;/h9-10H,1-6H2,(H,11,12)(H,13,14);2*1H |
| Isomeric SMILES | C(CNCCNCCC(=O)O)C(=O)O.Cl.Cl |
| PubChem CID | 11437359 |
| Molecular Weight | 277.15 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives |
| Direct Parent | Beta amino acids and derivatives |
| Alternative Parents | Dicarboxylic acids and derivatives Amino acids Dialkylamines Carboxylic acids Organic oxides Hydrochlorides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Beta amino acid or derivatives - Dicarboxylic acid or derivatives - Amino acid - Carboxylic acid - Secondary aliphatic amine - Secondary amine - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Organic oxygen compound - Amine - Carbonyl group - Hydrochloride - Hydrocarbon derivative - Organic oxide - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as beta amino acids and derivatives. These are amino acids having a (-NH2) group attached to the beta carbon atom. |
| External Descriptors | Not available |
| Solubility | souble in water |
|---|---|
| Melt Point(°C) | 225 °C(dec.) |
| Molecular Weight | 277.140 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 6 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 9 |
| Exact Mass | 276.064 Da |
| Monoisotopic Mass | 276.064 Da |
| Topological Polar Surface Area | 98.700 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 164.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 3 |