Determine the necessary mass, volume, or concentration for preparing a solution.
≥99%(T) for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | CC[P+](CC)(CC)CC.F[P-](F)(F)(F)(F)F |
|---|---|
| IUPAC Name | tetraethylphosphanium;hexafluorophosphate |
| InChIKey | WJZBUQKNTCKXAE-UHFFFAOYSA-N |
| INCHI | 1S/C8H20P.F6P/c1-5-9(6-2,7-3)8-4;1-7(2,3,4,5)6/h5-8H2,1-4H3;/q+1;-1 |
| Isomeric SMILES | CC[P+](CC)(CC)CC.F[P-](F)(F)(F)(F)F |
| PubChem CID | 2760564 |
| Molecular Weight | 292.19 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organophosphorus compounds |
| Class | Tetraalkylphosphonium compounds |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Tetraalkylphosphonium compounds |
| Alternative Parents | Organopnictogen compounds Organic salts Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Tetraalkylphosphonium compound - Organopnictogen compound - Hydrocarbon derivative - Organic salt - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as tetraalkylphosphonium compounds. These are organophosphorus compounds that contain a tetravalent phosphorus atom substituted to four alkyl chains. |
| External Descriptors | Not available |
| Sensitivity | Hygroscopic |
|---|---|
| Molecular Weight | 292.180 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 4 |
| Exact Mass | 292.094 Da |
| Monoisotopic Mass | 292.094 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 110.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |