Determine the necessary mass, volume, or concentration for preparing a solution.
≥97%(GC), 1M in hexane for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 1 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | CCN(CC)P1(=NC(C)(C)C)N(CCCN1C)C |
|---|---|
| IUPAC Name | 2-tert-butylimino-N,N-diethyl-1,3-dimethyl-1,3,2λ5-diazaphosphinan-2-amine |
| InChIKey | VSCBATMPTLKTOV-UHFFFAOYSA-N |
| INCHI | 1S/C13H31N4P/c1-8-17(9-2)18(14-13(3,4)5)15(6)11-10-12-16(18)7/h8-12H2,1-7H3 |
| Isomeric SMILES | CCN(CC)P1(=NC(C)(C)C)N(CCCN1C)C |
| WGK Germany | 3 |
| Molecular Weight | 274.39 |
| Beilstein | 5534901 |
| Reaxy-Rn | 5534901 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=5534901&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Azacyclic compounds |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Azacyclic compounds |
| Alternative Parents | Organonitrogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Azacycle - Organic nitrogen compound - Hydrocarbon derivative - Organonitrogen compound - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as azacyclic compounds. These are organic compounds containing an heterocycle with at least one nitrogen atom and one carbon atom linked to each other. |
| External Descriptors | Not available |
| Refractive Index | n20D1.48 (lit.) |
|---|---|
| Flash Point(°F) | 230.0 °F |
| Flash Point(°C) | 110 °C |
| Boil Point(°C) | 74° C (lit.) at 0.03 mmHg |
| Molecular Weight | 274.390 g/mol |
| XLogP3 | 2.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 4 |
| Exact Mass | 274.229 Da |
| Monoisotopic Mass | 274.229 Da |
| Topological Polar Surface Area | 22.100 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 303.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Kai-Xuan Qin, Shi-Si Li, Jing Xu, Zi-Long Li, Zi-Chen Li, Chunzu Cheng. (2022) Citronella-based polyesters by organocatalyzed ring-opening polymerization and their recyclable crosslinked films. EUROPEAN POLYMER JOURNAL, [PMID:] [10.1016/j.eurpolymj.2022.111803] |