≥99% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 1 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 504768070 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504768070 |
| Canonical Smiles | [O-]P(=O)=O.[O-]P(=O)=O.[Mg+2] |
| InChIKey | RHJYKEDKMHDZBL-UHFFFAOYSA-L |
| INCHI | 1S/Mg.2HO3P/c;2*1-4(2)3/h;2*(H,1,2,3)/q+2;;/p-2 |
| Isomeric SMILES | [O-]P(=O)=O.[O-]P(=O)=O.[Mg+2] |
| Molecular Weight | 182.25 |
| Reaxy-Rn | 16828910 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=16828910&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Inorganic compounds |
|---|---|
| Superclass | Mixed metal/non-metal compounds |
| Class | Alkaline earth metal organides |
| Subclass | Alkaline earth metal oxides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Alkaline earth metal oxides |
| Alternative Parents | Inorganic salts Inorganic oxides |
| Molecular Framework | Not available |
| Substituents | Alkaline earth metal oxide - Inorganic oxide - Inorganic salt |
| Description | This compound belongs to the class of inorganic compounds known as alkaline earth metal oxides. These are inorganic compounds containing an oxygen atom of an oxidation state of -2, in which the heaviest atom bonded to the oxygen is an alkaline earth metal. |
| External Descriptors | Not available |
| Molecular Weight | 182.250 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 0 |
| Exact Mass | 181.902 Da |
| Monoisotopic Mass | 181.902 Da |
| Topological Polar Surface Area | 114.000 Ų |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 36.500 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 3 |
| 1. Ziang Su, Xin Wang, Yan Sun, Ruilin Zheng, Lu Deng, Pengpeng Su, Xinyu Liu, Lili Hu, Shubin Chen. (2026) From structural evolution to property regulation: The role of fluorine in neodymium-doped phosphate glasses. JOURNAL OF NON-CRYSTALLINE SOLIDS, [PMID:] [10.1016/j.jnoncrysol.2026.124034] |
H2309533