Determine the necessary mass, volume, or concentration for preparing a solution.
≥98 atom% D,≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Product Application:
Pyrazine-d4 is the isotope labelled analog of Pyrazine which together, with its related heterocyclic compounds, have shown to have good antimicobacterial, anitbacterial, antifungal, cytotoxic, and oxidant activities.
| Pubchem Sid | 508812928 |
|---|---|
| Canonical Smiles | C1=CN=CC=N1 |
| IUPAC Name | 2,3,5,6-tetradeuteriopyrazine |
| InChIKey | KYQCOXFCLRTKLS-RHQRLBAQSA-N |
| INCHI | 1S/C4H4N2/c1-2-6-4-3-5-1/h1-4H/i1D,2D,3D,4D |
| Isomeric SMILES | [2H]C1=C(N=C(C(=N1)[2H])[2H])[2H] |
| Molecular Weight | 84.11 |
| Reaxy-Rn | 103905 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=103905&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Diazines |
| Subclass | Pyrazines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyrazines |
| Alternative Parents | Heteroaromatic compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Pyrazine - Heteroaromatic compound - Azacycle - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organonitrogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrazines. These are compounds containing a pyrazine ring, which is a six-member aromatic heterocycle, that consists of two nitrogen atoms (at positions 1 and 4) and four carbon atoms. |
| External Descriptors | Not available |
| Solubility | Acetone (Slightly) |
|---|---|
| Boil Point(°C) | 116° C (lit.) |
| Melt Point(°C) | 55-57° C (lit.) |
| Molecular Weight | 84.110 g/mol |
| XLogP3 | -0.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 84.0626 Da |
| Monoisotopic Mass | 84.0626 Da |
| Topological Polar Surface Area | 25.800 Ų |
| Heavy Atom Count | 6 |
| Formal Charge | 0 |
| Complexity | 26.500 |
| Isotope Atom Count | 4 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |