≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
SPDP-PEG4-acid is a PEG derivative contianing SPDP crosslinker and carboxylic acid moieties. SPDP is reactive toward amine and thiol groups and contains a cleavable disulfide bond. Its membrane permeability allows for intracellular crosslinking reactions. The terminal caboxylic acid can react with primary amines in the presence of activators such as EDC and DCC to form stable amide bonds. The hydrophilic properties of the PEG linkers increase compound solubility in aqueous media. The water solubility properties of PEG linkers is enhanced by longer PEG chains.
| Canonical Smiles | C1=CC=NC(=C1)SSCCC(=O)NCCOCCOCCOCCOCCC(=O)O |
|---|---|
| IUPAC Name | 3-[2-[2-[2-[2-[3-(pyridin-2-yldisulfanyl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | IJDPYTZOKIVWAN-UHFFFAOYSA-N |
| INCHI | 1S/C19H30N2O7S2/c22-17(5-16-29-30-18-3-1-2-6-21-18)20-7-9-26-11-13-28-15-14-27-12-10-25-8-4-19(23)24/h1-3,6H,4-5,7-16H2,(H,20,22)(H,23,24) |
| Isomeric SMILES | C1=CC=NC(=C1)SSCCC(=O)NCCOCCOCCOCCOCCC(=O)O |
| Alternate CAS | 581065-97-6 |
| PubChem CID | 51341021 |
| Molecular Weight | 462.6 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyridines and derivatives |
| Alternative Parents | Heteroaromatic compounds Secondary carboxylic acid amides Organic disulfides Sulfenyl compounds Monocarboxylic acids and derivatives Dialkyl ethers Carboxylic acids Azacyclic compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Pyridine - Heteroaromatic compound - Carboxamide group - Organic disulfide - Secondary carboxylic acid amide - Carboxylic acid derivative - Carboxylic acid - Dialkyl ether - Ether - Monocarboxylic acid or derivatives - Sulfenyl compound - Azacycle - Organic oxygen compound - Carbonyl group - Organonitrogen compound - Organooxygen compound - Organosulfur compound - Organic oxide - Hydrocarbon derivative - Organic nitrogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyridines and derivatives. These are compounds containing a pyridine ring, which is a six-member aromatic heterocycle which consists of one nitrogen atom and five carbon atoms. |
| External Descriptors | Not available |
| Molecular Weight | 462.600 g/mol |
|---|---|
| XLogP3 | -0.100 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 10 |
| Rotatable Bond Count | 20 |
| Exact Mass | 462.149 Da |
| Monoisotopic Mass | 462.149 Da |
| Topological Polar Surface Area | 167.000 Ų |
| Heavy Atom Count | 30 |
| Formal Charge | 0 |
| Complexity | 447.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
