Determine the necessary mass, volume, or concentration for preparing a solution.
≥99% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 2 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | C1=COC(=C1)P(C2=CC=CO2)C3=CC=CO3 |
|---|---|
| IUPAC Name | tris(furan-2-yl)phosphane |
| InChIKey | DLQYXUGCCKQSRJ-UHFFFAOYSA-N |
| INCHI | 1S/C12H9O3P/c1-4-10(13-7-1)16(11-5-2-8-14-11)12-6-3-9-15-12/h1-9H |
| Isomeric SMILES | C1=COC(=C1)P(C2=CC=CO2)C3=CC=CO3 |
| WGK Germany | 3 |
| PubChem CID | 521585 |
| Molecular Weight | 232.17 |
| Beilstein | 1577564 |
| Reaxy-Rn | 1577564 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Heteroaromatic compounds |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Heteroaromatic compounds |
| Alternative Parents | Furans Organic phosphines and derivatives Oxacyclic compounds Organopnictogen compounds Organooxygen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Heteroaromatic compound - Furan - Phosphine - Oxacycle - Organic oxygen compound - Organopnictogen compound - Hydrocarbon derivative - Organophosphorus compound - Organooxygen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as heteroaromatic compounds. These are compounds containing an aromatic ring where a carbon atom is linked to an hetero atom. |
| External Descriptors | Not available |
| Boil Point(°C) | 136°C |
|---|---|
| Melt Point(°C) | 61-64°C |
| Molecular Weight | 232.170 g/mol |
| XLogP3 | 2.800 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 232.029 Da |
| Monoisotopic Mass | 232.029 Da |
| Topological Polar Surface Area | 39.400 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 198.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Congxiao Wu, Zhicheng Wang, Xudong Hu, Hao Zhang, Zhikang Xu, Jianjia Li, Xiaoming Li. (2025) Copper-Iodide Cluster Ink for Fast and Robust Anti-Counterfeiting and Erasable Encryption. Advanced Optical Materials, [PMID:] [10.1002/adom.202502169] |
| 2. Jiansheng Ye, Yali Dai, Wenjun Liu, Jingrou Xu, Jialing Li, Meng Chen, Sha Yang, Qinzhen Li, Yuanxin Du, Jinsong Chai, Manzhou Zhu. (2025) Phosphine-induced conversion from Au36 to Au32 for constructing a high-performance CO2RR catalyst. DALTON TRANSACTIONS, 54 (23): (9160-9168). [PMID:40384284] [10.1039/D5DT00604J] |