Determine the necessary mass, volume, or concentration for preparing a solution.
Fmoc-Lys(Dabcyl)-OH is a building block for in-sequence Lys labeling by Dabcyl. Dabcyl is one of the most common acceptor dyes for preparing FRET peptides (often paired with EDANS or TF1).
| Pubchem Sid | 504761436 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504761436 |
| Canonical Smiles | CN(C)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)C(=O)NCCCCC(C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
| IUPAC Name | (2S)-6-[[4-[[4-(dimethylamino)phenyl]diazenyl]benzoyl]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
| InChIKey | FPOPWTDBGMLRNG-XIFFEERXSA-N |
| INCHI | 1S/C36H37N5O5/c1-41(2)27-20-18-26(19-21-27)40-39-25-16-14-24(15-17-25)34(42)37-22-8-7-13-33(35(43)44)38-36(45)46-23-32-30-11-5-3-9-28(30)29-10-4-6-12-31(29)32/h3-6,9-12,14-21,32-33H,7-8,13,22-23H2,1-2H3,(H,37,42)(H,38,45)(H,43,44)/t33-/m0/s1 |
| Isomeric SMILES | CN(C)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)C(=O)NCCCC[C@@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
| Molecular Weight | 619.71 |
| Reaxy-Rn | 8601019 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=8601019&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Azobenzenes |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Azobenzenes |
| Alternative Parents | Fluorenes Alpha amino acids and derivatives Benzamides Aniline and substituted anilines Benzoyl derivatives Dialkylarylamines Medium-chain fatty acids Amino fatty acids Carbamate esters Amino acids Azo compounds Secondary carboxylic acid amides Organic carbonic acids and derivatives Carboxylic acids Propargyl-type 1,3-dipolar organic compounds Monocarboxylic acids and derivatives Hydrocarbon derivatives Organopnictogen compounds Carbonyl compounds Organic oxides |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | Azobenzene - Fluorene - Alpha-amino acid or derivatives - Benzamide - Benzoic acid or derivatives - Benzoyl - Tertiary aliphatic/aromatic amine - Medium-chain fatty acid - Dialkylarylamine - Aniline or substituted anilines - Amino fatty acid - Fatty acyl - Fatty acid - Benzenoid - Monocyclic benzene moiety - Carbamic acid ester - Amino acid - Azo compound - Amino acid or derivatives - Carboxamide group - Carbonic acid derivative - Secondary carboxylic acid amide - Tertiary amine - Carboxylic acid - Carboxylic acid derivative - Propargyl-type 1,3-dipolar organic compound - Organic 1,3-dipolar compound - Monocarboxylic acid or derivatives - Organic oxide - Carbonyl group - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organonitrogen compound - Organooxygen compound - Amine - Organic oxygen compound - Aromatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as azobenzenes. These are organonitrogen aromatic compounds that contain a central azo group, where each nitrogen atom is conjugated to a benzene ring. |
| External Descriptors | Not available |
| Molecular Weight | 619.700 g/mol |
|---|---|
| XLogP3 | 6.600 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 8 |
| Rotatable Bond Count | 14 |
| Exact Mass | 619.279 Da |
| Monoisotopic Mass | 619.279 Da |
| Topological Polar Surface Area | 133.000 Ų |
| Heavy Atom Count | 46 |
| Formal Charge | 0 |
| Complexity | 1000.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |