Determine the necessary mass, volume, or concentration for preparing a solution.
≥98%(T) for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Argon charged Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 504767591 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504767591 |
| Canonical Smiles | C(F)(F)(F)S(=O)[O-].C(F)(F)(F)S(=O)[O-].[Zn+2] |
| IUPAC Name | zinc;trifluoromethanesulfinate |
| InChIKey | UANOWFITUWBPCF-UHFFFAOYSA-L |
| INCHI | 1S/2CHF3O2S.Zn/c2*2-1(3,4)7(5)6;/h2*(H,5,6);/q;;+2/p-2 |
| Isomeric SMILES | C(F)(F)(F)S(=O)[O-].C(F)(F)(F)S(=O)[O-].[Zn+2] |
| PubChem CID | 14174735 |
| Molecular Weight | 367.51 |
| Reaxy-Rn | 3723693 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organohalogen compounds |
| Class | Alkyl halides |
| Subclass | Halomethanes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Trihalomethanes |
| Alternative Parents | Alkanesulfinic acids Organic transition metal salts Organic metal halides Organosulfur compounds Organofluorides Organic oxides Hydrocarbon derivatives Alkyl fluorides Organic cations |
| Molecular Framework | Not available |
| Substituents | Trihalomethane - Alkanesulfinic acid - Alkanesulfinic acid or derivatives - Sulfinic acid derivative - Organic metal halide - Organic transition metal salt - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organic salt - Organosulfur compound - Organofluoride - Alkyl fluoride - Organic cation - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as trihalomethanes. These are organic compounds in which exactly three of the four hydrogen atoms of methane (CH4) are replaced by halogen atoms. |
| External Descriptors | Not available |
| Solubility | Soluble in water |
|---|---|
| Sensitivity | Hygroscopic,Heat Sensitive |
| Melt Point(°C) | 157 °C |
| Molecular Weight | 331.500 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 12 |
| Rotatable Bond Count | 0 |
| Exact Mass | 329.843 Da |
| Monoisotopic Mass | 329.843 Da |
| Topological Polar Surface Area | 119.000 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 79.900 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 3 |